C18H27N3 — CID 145297840
N'-[4-[(cyclohexa-2,4-dien-1-ylmethylamino)methyl]cyclohexa-1,3-dien-1-yl]-N-ethyl-N-methylmethanimidamide (PubChem CID 145297840) has the molecular formula C18H27N3 and a molecular weight of 285.44 g/mol. Its IUPAC name is N'-[4-[(cyclohexa-2,4-dien-1-ylmethylamino)methyl]cyclohexa-1,3-dien-1-yl]-N-ethyl-N-methylmethanimidamide.
| Compound Name | N'-[4-[(cyclohexa-2,4-dien-1-ylmethylamino)methyl]cyclohexa-1,3-dien-1-yl]-N-ethyl-N-methylmethanimidamide |
|---|---|
| PubChem CID | 145297840 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | N'-[4-[(cyclohexa-2,4-dien-1-ylmethylamino)methyl]cyclohexa-1,3-dien-1-yl]-N-ethyl-N-methylmethanimidamide |
| SMILES | CCN(C)/C=N/C1=CC=C(CNCC2C=CC=CC2)CC1 |
| InChI | InChI=1S/C18H27N3/c1-3-21(2)15-20-18-11-9-17(10-12-18)14-19-13-16-7-5-4-6-8-16/h4-7,9,11,15-16,19H,3,8,10,12-14H2,1-2H3/b20-15+ |
| InChIKey | HJNZVNDSVHPDMZ-HMMYKYKNSA-N |
| XLogP | 3.29 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|