C20H36N4 — CID 123483519
N-[(3Z)-3-(aminomethyl)penta-1,3-dien-2-yl]-N'-[3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)propyl]pentanimidamide (PubChem CID 123483519) has the molecular formula C20H36N4 and a molecular weight of 332.54 g/mol. Its IUPAC name is N-[(3Z)-3-(aminomethyl)penta-1,3-dien-2-yl]-N'-[3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)propyl]pentanimidamide.
| Compound Name | N-[(3Z)-3-(aminomethyl)penta-1,3-dien-2-yl]-N'-[3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)propyl]pentanimidamide |
|---|---|
| PubChem CID | 123483519 |
| Molecular Formula | C20H36N4 |
| Molecular Weight | 332.54 g/mol |
| Exact Mass | 332.29 |
| IUPAC Name | N-[(3Z)-3-(aminomethyl)penta-1,3-dien-2-yl]-N'-[3-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)propyl]pentanimidamide |
| SMILES | C=C(N/C(CCCC)=N/CCCC1=CCN(C)CC1)/C(=C\C)CN |
| InChI | InChI=1S/C20H36N4/c1-5-7-10-20(23-17(3)19(6-2)16-21)22-13-8-9-18-11-14-24(4)15-12-18/h6,11H,3,5,7-10,12-16,21H2,1-2,4H3,(H,22,23)/b19-6- |
| InChIKey | GFJXDCUATCRAQD-SWNXQHNESA-N |
| XLogP | 3.63 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.54 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|