C26H46N3+ — CID 77379698
[5-(cycloundecen-1-yl)-1,5-diazacycloundec-6-ylidene]-bis(prop-2-enyl)azanium (PubChem CID 77379698) has the molecular formula C26H46N3+ and a molecular weight of 400.68 g/mol. Its IUPAC name is [5-(cycloundecen-1-yl)-1,5-diazacycloundec-6-ylidene]-bis(prop-2-enyl)azanium.
| Compound Name | [5-(cycloundecen-1-yl)-1,5-diazacycloundec-6-ylidene]-bis(prop-2-enyl)azanium |
|---|---|
| PubChem CID | 77379698 |
| Molecular Formula | C26H46N3+ |
| Molecular Weight | 400.68 g/mol |
| Exact Mass | 400.37 |
| IUPAC Name | [5-(cycloundecen-1-yl)-1,5-diazacycloundec-6-ylidene]-bis(prop-2-enyl)azanium |
| SMILES | C=CC[N+](CC=C)=C1CCCCCNCCCN1C1=CCCCCCCCCC1 |
| InChI | InChI=1S/C26H46N3/c1-3-22-28(23-4-2)26-19-14-11-15-20-27-21-16-24-29(26)25-17-12-9-7-5-6-8-10-13-18-25/h3-4,17,27H,1-2,5-16,18-24H2/q+1 |
| InChIKey | AFQSTJHWBBEDQB-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 18.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.68 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|