About [5-(cycloundecen-1-yl)-1,5-diazacycloundec-6-ylidene]-bis(prop-2-enyl)azanium
[5-(cycloundecen-1-yl)-1,5-diazacycloundec-6-ylidene]-bis(prop-2-enyl)azanium (PubChem CID 77379698) has the molecular formula C26H46N3+
and a molecular weight of 400.68 g/mol. Its IUPAC name is [5-(cycloundecen-1-yl)-1,5-diazacycloundec-6-ylidene]-bis(prop-2-enyl)azanium.
Molecular Properties
| Compound Name | [5-(cycloundecen-1-yl)-1,5-diazacycloundec-6-ylidene]-bis(prop-2-enyl)azanium |
| PubChem CID | 77379698 |
| Molecular Formula | C26H46N3+ |
| Molecular Weight | 400.68 g/mol |
| Exact Mass | 400.37 |
| IUPAC Name | [5-(cycloundecen-1-yl)-1,5-diazacycloundec-6-ylidene]-bis(prop-2-enyl)azanium |
| SMILES | C=CC[N+](CC=C)=C1CCCCCNCCCN1C1=CCCCCCCCCC1 |
| InChI | InChI=1S/C26H46N3/c1-3-22-28(23-4-2)26-19-14-11-15-20-27-21-16-24-29(26)25-17-12-9-7-5-6-8-10-13-18-25/h3-4,17,27H,1-2,5-16,18-24H2/q+1 |
| InChIKey | AFQSTJHWBBEDQB-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 18.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.68 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze [5-(cycloundecen-1-yl)-1,5-diazacycloundec-6-ylidene]-bis(prop-2-enyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(cycloundecen-1-yl)-1,5-diazacycloundec-6-ylidene]-bis(prop-2-enyl)azanium?
The IUPAC name of [5-(cycloundecen-1-yl)-1,5-diazacycloundec-6-ylidene]-bis(prop-2-enyl)azanium (CID 77379698) is [5-(cycloundecen-1-yl)-1,5-diazacycloundec-6-ylidene]-bis(prop-2-enyl)azanium.
What is the SMILES notation for [5-(cycloundecen-1-yl)-1,5-diazacycloundec-6-ylidene]-bis(prop-2-enyl)azanium?
The canonical SMILES for [5-(cycloundecen-1-yl)-1,5-diazacycloundec-6-ylidene]-bis(prop-2-enyl)azanium is C=CC[N+](CC=C)=C1CCCCCNCCCN1C1=CCCCCCCCCC1.
What is the InChIKey of [5-(cycloundecen-1-yl)-1,5-diazacycloundec-6-ylidene]-bis(prop-2-enyl)azanium?
The InChIKey is AFQSTJHWBBEDQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H46N3/c1-3-22-28(23-4-2)26-19-14-11-15-20-27-21-16-24-29(26)25-17-12-9-7-5-6-8-10-13-18-25/h3-4,17,27H,1-2,5-16,18-24H2/q+1.
What are the key properties of [5-(cycloundecen-1-yl)-1,5-diazacycloundec-6-ylidene]-bis(prop-2-enyl)azanium?
[5-(cycloundecen-1-yl)-1,5-diazacycloundec-6-ylidene]-bis(prop-2-enyl)azanium has a molecular weight of 400.68 g/mol, XLogP of 6.03, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(cycloundecen-1-yl)-1,5-diazacycloundec-6-ylidene]-bis(prop-2-enyl)azanium is sourced from PubChem (CID 77379698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).