C13H23N3 — CID 22886485
2-[4-(1,2,3,4-tetrahydropyridin-6-yl)butyl]-1,4,5,6-tetrahydropyrimidine (PubChem CID 22886485) has the molecular formula C13H23N3 and a molecular weight of 221.35 g/mol. Its IUPAC name is 2-[4-(1,2,3,4-tetrahydropyridin-6-yl)butyl]-1,4,5,6-tetrahydropyrimidine.
| Compound Name | 2-[4-(1,2,3,4-tetrahydropyridin-6-yl)butyl]-1,4,5,6-tetrahydropyrimidine |
|---|---|
| PubChem CID | 22886485 |
| Molecular Formula | C13H23N3 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | 2-[4-(1,2,3,4-tetrahydropyridin-6-yl)butyl]-1,4,5,6-tetrahydropyrimidine |
| SMILES | C1=C(CCCCC2=NCCCN2)NCCC1 |
| InChI | InChI=1S/C13H23N3/c1(6-12-7-3-4-9-14-12)2-8-13-15-10-5-11-16-13/h7,14H,1-6,8-11H2,(H,15,16) |
| InChIKey | NBWWOQWCNQIJJQ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|