C12H21N3 — CID 21340231
2-[3-(1,2,3,4-tetrahydropyridin-6-yl)propyl]-1,4,5,6-tetrahydropyrimidine (PubChem CID 21340231) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is 2-[3-(1,2,3,4-tetrahydropyridin-6-yl)propyl]-1,4,5,6-tetrahydropyrimidine.
| Compound Name | 2-[3-(1,2,3,4-tetrahydropyridin-6-yl)propyl]-1,4,5,6-tetrahydropyrimidine |
|---|---|
| PubChem CID | 21340231 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | 2-[3-(1,2,3,4-tetrahydropyridin-6-yl)propyl]-1,4,5,6-tetrahydropyrimidine |
| SMILES | C1=C(CCCC2=NCCCN2)NCCC1 |
| InChI | InChI=1S/C12H21N3/c1-2-8-13-11(5-1)6-3-7-12-14-9-4-10-15-12/h5,13H,1-4,6-10H2,(H,14,15) |
| InChIKey | GAMULOWXZUZUTJ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |