C10H18N3+ — CID 21340216
2-(1,2,3,4-tetrahydropyridin-6-ylmethyl)-1,4,5,6-tetrahydropyrimidin-3-ium (PubChem CID 21340216) has the molecular formula C10H18N3+ and a molecular weight of 180.27 g/mol. Its IUPAC name is 2-(1,2,3,4-tetrahydropyridin-6-ylmethyl)-1,4,5,6-tetrahydropyrimidin-3-ium.
| Compound Name | 2-(1,2,3,4-tetrahydropyridin-6-ylmethyl)-1,4,5,6-tetrahydropyrimidin-3-ium |
|---|---|
| PubChem CID | 21340216 |
| Molecular Formula | C10H18N3+ |
| Molecular Weight | 180.27 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | 2-(1,2,3,4-tetrahydropyridin-6-ylmethyl)-1,4,5,6-tetrahydropyrimidin-3-ium |
| SMILES | C1=C(CC2=[NH+]CCCN2)NCCC1 |
| InChI | InChI=1S/C10H17N3/c1-2-5-11-9(4-1)8-10-12-6-3-7-13-10/h4,11H,1-3,5-8H2,(H,12,13)/p+1 |
| InChIKey | VMUMQCZZJDOUSR-UHFFFAOYSA-O |
| XLogP | -0.88 |
| TPSA | 38.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.27 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |