C12H22N3+ — CID 21340230
2-[3-(1,2,3,4-tetrahydropyridin-6-yl)propyl]-1,4,5,6-tetrahydropyrimidin-3-ium (PubChem CID 21340230) has the molecular formula C12H22N3+ and a molecular weight of 208.33 g/mol. Its IUPAC name is 2-[3-(1,2,3,4-tetrahydropyridin-6-yl)propyl]-1,4,5,6-tetrahydropyrimidin-3-ium.
| Compound Name | 2-[3-(1,2,3,4-tetrahydropyridin-6-yl)propyl]-1,4,5,6-tetrahydropyrimidin-3-ium |
|---|---|
| PubChem CID | 21340230 |
| Molecular Formula | C12H22N3+ |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | 2-[3-(1,2,3,4-tetrahydropyridin-6-yl)propyl]-1,4,5,6-tetrahydropyrimidin-3-ium |
| SMILES | C1=C(CCCC2=[NH+]CCCN2)NCCC1 |
| InChI | InChI=1S/C12H21N3/c1-2-8-13-11(5-1)6-3-7-12-14-9-4-10-15-12/h5,13H,1-4,6-10H2,(H,14,15)/p+1 |
| InChIKey | GAMULOWXZUZUTJ-UHFFFAOYSA-O |
| XLogP | -0.10 |
| TPSA | 38.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |