C10H17N3 — CID 21340217
2-(1,2,3,4-tetrahydropyridin-6-ylmethyl)-1,4,5,6-tetrahydropyrimidine (PubChem CID 21340217) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is 2-(1,2,3,4-tetrahydropyridin-6-ylmethyl)-1,4,5,6-tetrahydropyrimidine.
| Compound Name | 2-(1,2,3,4-tetrahydropyridin-6-ylmethyl)-1,4,5,6-tetrahydropyrimidine |
|---|---|
| PubChem CID | 21340217 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 2-(1,2,3,4-tetrahydropyridin-6-ylmethyl)-1,4,5,6-tetrahydropyrimidine |
| SMILES | C1=C(CC2=NCCCN2)NCCC1 |
| InChI | InChI=1S/C10H17N3/c1-2-5-11-9(4-1)8-10-12-6-3-7-13-10/h4,11H,1-3,5-8H2,(H,12,13) |
| InChIKey | VMUMQCZZJDOUSR-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |