C8H15N3 — CID 137090868
2-(2-methylimino-3,4-dihydro-1H-pyridin-6-yl)ethanamine (PubChem CID 137090868) has the molecular formula C8H15N3 and a molecular weight of 153.23 g/mol. Its IUPAC name is 2-(2-methylimino-3,4-dihydro-1H-pyridin-6-yl)ethanamine.
| Compound Name | 2-(2-methylimino-3,4-dihydro-1H-pyridin-6-yl)ethanamine |
|---|---|
| PubChem CID | 137090868 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | 2-(2-methylimino-3,4-dihydro-1H-pyridin-6-yl)ethanamine |
| SMILES | C/N=C1\CCC=C(CCN)N1 |
| InChI | InChI=1S/C8H15N3/c1-10-8-4-2-3-7(11-8)5-6-9/h3H,2,4-6,9H2,1H3,(H,10,11) |
| InChIKey | WETSPBHCRUZPCR-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|