C25H35N3 — CID 144904277
N'-methyl-N-[(4Z,8Z)-11-(methylamino)-3,6,7,10-tetramethylidenedodeca-1,4,8,11-tetraen-2-yl]cyclohexanecarboximidamide (PubChem CID 144904277) has the molecular formula C25H35N3 and a molecular weight of 377.58 g/mol. Its IUPAC name is N'-methyl-N-[(4Z,8Z)-11-(methylamino)-3,6,7,10-tetramethylidenedodeca-1,4,8,11-tetraen-2-yl]cyclohexanecarboximidamide.
| Compound Name | N'-methyl-N-[(4Z,8Z)-11-(methylamino)-3,6,7,10-tetramethylidenedodeca-1,4,8,11-tetraen-2-yl]cyclohexanecarboximidamide |
|---|---|
| PubChem CID | 144904277 |
| Molecular Formula | C25H35N3 |
| Molecular Weight | 377.58 g/mol |
| Exact Mass | 377.28 |
| IUPAC Name | N'-methyl-N-[(4Z,8Z)-11-(methylamino)-3,6,7,10-tetramethylidenedodeca-1,4,8,11-tetraen-2-yl]cyclohexanecarboximidamide |
| SMILES | C=C(/C=C\C(=C)C(=C)NC)C(=C)/C=C\C(=C)C(=C)N/C(=N\C)C1CCCCC1 |
| InChI | InChI=1S/C25H35N3/c1-18(14-16-20(3)22(5)26-7)19(2)15-17-21(4)23(6)28-25(27-8)24-12-10-9-11-13-24/h14-17,24,26H,1-6,9-13H2,7-8H3,(H,27,28)/b16-14-,17-15- |
| InChIKey | BDFLYUTWQKMCOH-RYOQUFEFSA-N |
| XLogP | 5.77 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.58 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|