C18H24N2 — CID 123388354
2-cyclohexyl-5-methyl-3a,9,9a,9b-tetrahydro-1H-perimidine (PubChem CID 123388354) has the molecular formula C18H24N2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 2-cyclohexyl-5-methyl-3a,9,9a,9b-tetrahydro-1H-perimidine.
| Compound Name | 2-cyclohexyl-5-methyl-3a,9,9a,9b-tetrahydro-1H-perimidine |
|---|---|
| PubChem CID | 123388354 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 2-cyclohexyl-5-methyl-3a,9,9a,9b-tetrahydro-1H-perimidine |
| SMILES | CC1=CC2N=C(C3CCCCC3)NC3CC=CC(=C1)C23 |
| InChI | InChI=1S/C18H24N2/c1-12-10-14-8-5-9-15-17(14)16(11-12)20-18(19-15)13-6-3-2-4-7-13/h5,8,10-11,13,15-17H,2-4,6-7,9H2,1H3,(H,19,20) |
| InChIKey | BPXHFIGINIEYSN-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |