C21H31FN4 — CID 123498754
4-(2-aminoethylimino)-N-(5-fluoro-2-methylhepta-2,4,6-trienyl)-N,6-dimethyl-4a,5,8,8a-tetrahydro-3H-quinolin-2-amine (PubChem CID 123498754) has the molecular formula C21H31FN4 and a molecular weight of 358.51 g/mol. Its IUPAC name is 4-(2-aminoethylimino)-N-(5-fluoro-2-methylhepta-2,4,6-trienyl)-N,6-dimethyl-4a,5,8,8a-tetrahydro-3H-quinolin-2-amine.
| Compound Name | 4-(2-aminoethylimino)-N-(5-fluoro-2-methylhepta-2,4,6-trienyl)-N,6-dimethyl-4a,5,8,8a-tetrahydro-3H-quinolin-2-amine |
|---|---|
| PubChem CID | 123498754 |
| Molecular Formula | C21H31FN4 |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | 4-(2-aminoethylimino)-N-(5-fluoro-2-methylhepta-2,4,6-trienyl)-N,6-dimethyl-4a,5,8,8a-tetrahydro-3H-quinolin-2-amine |
| SMILES | C=CC(F)=CC=C(C)CN(C)C1=NC2CC=C(C)CC2/C(=N/CCN)C1 |
| InChI | InChI=1S/C21H31FN4/c1-5-17(22)8-6-16(3)14-26(4)21-13-20(24-11-10-23)18-12-15(2)7-9-19(18)25-21/h5-8,18-19H,1,9-14,23H2,2-4H3/b16-6?,17-8?,24-20+ |
| InChIKey | ZIOVNNDSBQGWML-FSZFVJFESA-N |
| XLogP | 3.83 |
| TPSA | 53.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|