C27H45N3 — CID 123960329
(3E,4Z)-2-imino-N'-methyl-4-(3-methylbutan-2-yl)-N-(7-methylnona-2,7-dien-2-yl)-3-propylideneocta-4,6-dienimidamide (PubChem CID 123960329) has the molecular formula C27H45N3 and a molecular weight of 411.68 g/mol. Its IUPAC name is (3E,4Z)-2-imino-N'-methyl-4-(3-methylbutan-2-yl)-N-(7-methylnona-2,7-dien-2-yl)-3-propylideneocta-4,6-dienimidamide.
| Compound Name | (3E,4Z)-2-imino-N'-methyl-4-(3-methylbutan-2-yl)-N-(7-methylnona-2,7-dien-2-yl)-3-propylideneocta-4,6-dienimidamide |
|---|---|
| PubChem CID | 123960329 |
| Molecular Formula | C27H45N3 |
| Molecular Weight | 411.68 g/mol |
| Exact Mass | 411.36 |
| IUPAC Name | (3E,4Z)-2-imino-N'-methyl-4-(3-methylbutan-2-yl)-N-(7-methylnona-2,7-dien-2-yl)-3-propylideneocta-4,6-dienimidamide |
| SMILES | [H]/N=C(C(=N\C)\NC(C)=CCCCC(C)=CC)/C(=C/CC)C(=C\C=CC)/C(C)C(C)C |
| InChI | InChI=1S/C27H45N3/c1-10-13-19-24(23(8)20(4)5)25(16-11-2)26(28)27(29-9)30-22(7)18-15-14-17-21(6)12-3/h10,12-13,16,18-20,23,28H,11,14-15,17H2,1-9H3,(H,29,30)/b13-10?,21-12?,22-18?,24-19-,25-16+,28-26- |
| InChIKey | QLPQNHHTMJSTEF-SEPHIICSSA-N |
| XLogP | 7.80 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.68 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|