C31H51N3 — CID 123233034
N'-[(2Z,4E)-2-cyclopropyl-4-ethanimidoylhexa-2,4-dien-3-yl]-N-[(2E,4Z)-6-(4-ethylcyclohexyl)hepta-2,4-dien-3-yl]-2-methylbutanimidamide (PubChem CID 123233034) has the molecular formula C31H51N3 and a molecular weight of 465.77 g/mol. Its IUPAC name is N'-[(2Z,4E)-2-cyclopropyl-4-ethanimidoylhexa-2,4-dien-3-yl]-N-[(2E,4Z)-6-(4-ethylcyclohexyl)hepta-2,4-dien-3-yl]-2-methylbutanimidamide.
| Compound Name | N'-[(2Z,4E)-2-cyclopropyl-4-ethanimidoylhexa-2,4-dien-3-yl]-N-[(2E,4Z)-6-(4-ethylcyclohexyl)hepta-2,4-dien-3-yl]-2-methylbutanimidamide |
|---|---|
| PubChem CID | 123233034 |
| Molecular Formula | C31H51N3 |
| Molecular Weight | 465.77 g/mol |
| Exact Mass | 465.41 |
| IUPAC Name | N'-[(2Z,4E)-2-cyclopropyl-4-ethanimidoylhexa-2,4-dien-3-yl]-N-[(2E,4Z)-6-(4-ethylcyclohexyl)hepta-2,4-dien-3-yl]-2-methylbutanimidamide |
| SMILES | [H]/N=C(C)/C(=C/C)C(/N=C(\NC(/C=C\C(C)C1CCC(CC)CC1)=C/C)C(C)CC)=C(\C)C1CC1 |
| InChI | InChI=1S/C31H51N3/c1-9-21(5)31(34-30(23(7)27-18-19-27)29(12-4)24(8)32)33-28(11-3)20-13-22(6)26-16-14-25(10-2)15-17-26/h11-13,20-22,25-27,32H,9-10,14-19H2,1-8H3,(H,33,34)/b20-13-,28-11+,29-12-,30-23-,32-24+ |
| InChIKey | RBPNYFGSPFUEQY-VVJBXKKBSA-N |
| XLogP | 9.00 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.77 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|