C31H47N3 — CID 167215368
(3E,4Z)-2-N-[5-but-1-en-2-yl-4-[(Z)-4-propylhept-2-en-3-yl]-3H-pyrrol-2-yl]-3-ethylidene-7-N,7-N-dimethyl-6-methylideneocta-1,4,7-triene-2,7-diamine (PubChem CID 167215368) has the molecular formula C31H47N3 and a molecular weight of 461.74 g/mol. Its IUPAC name is (3E,4Z)-2-N-[5-but-1-en-2-yl-4-[(Z)-4-propylhept-2-en-3-yl]-3H-pyrrol-2-yl]-3-ethylidene-7-N,7-N-dimethyl-6-methylideneocta-1,4,7-triene-2,7-diamine.
| Compound Name | (3E,4Z)-2-N-[5-but-1-en-2-yl-4-[(Z)-4-propylhept-2-en-3-yl]-3H-pyrrol-2-yl]-3-ethylidene-7-N,7-N-dimethyl-6-methylideneocta-1,4,7-triene-2,7-diamine |
|---|---|
| PubChem CID | 167215368 |
| Molecular Formula | C31H47N3 |
| Molecular Weight | 461.74 g/mol |
| Exact Mass | 461.38 |
| IUPAC Name | (3E,4Z)-2-N-[5-but-1-en-2-yl-4-[(Z)-4-propylhept-2-en-3-yl]-3H-pyrrol-2-yl]-3-ethylidene-7-N,7-N-dimethyl-6-methylideneocta-1,4,7-triene-2,7-diamine |
| SMILES | C=C(/C=C\C(=C/C)C(=C)NC1=NC(C(=C)CC)=C(/C(=C\C)C(CCC)CCC)C1)C(=C)N(C)C |
| InChI | InChI=1S/C31H47N3/c1-12-17-27(18-13-2)28(16-5)29-21-30(33-31(29)22(6)14-3)32-24(8)26(15-4)20-19-23(7)25(9)34(10)11/h15-16,19-20,27H,6-9,12-14,17-18,21H2,1-5,10-11H3,(H,32,33)/b20-19-,26-15+,28-16- |
| InChIKey | ZHAAIVHBLYEROI-UJKNXWLCSA-N |
| XLogP | 8.41 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.74 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|