C17H35N3 — CID 155696643
N-[(E)-9-(dimethylamino)-4-methylidenenon-2-en-2-yl]-N'-methylethanimidamide;ethane (PubChem CID 155696643) has the molecular formula C17H35N3 and a molecular weight of 281.49 g/mol. Its IUPAC name is N-[(E)-9-(dimethylamino)-4-methylidenenon-2-en-2-yl]-N'-methylethanimidamide;ethane.
| Compound Name | N-[(E)-9-(dimethylamino)-4-methylidenenon-2-en-2-yl]-N'-methylethanimidamide;ethane |
|---|---|
| PubChem CID | 155696643 |
| Molecular Formula | C17H35N3 |
| Molecular Weight | 281.49 g/mol |
| Exact Mass | 281.28 |
| IUPAC Name | N-[(E)-9-(dimethylamino)-4-methylidenenon-2-en-2-yl]-N'-methylethanimidamide;ethane |
| SMILES | C=C(/C=C(\C)N/C(C)=N/C)CCCCCN(C)C.CC |
| InChI | InChI=1S/C15H29N3.C2H6/c1-13(10-8-7-9-11-18(5)6)12-14(2)17-15(3)16-4;1-2/h12H,1,7-11H2,2-6H3,(H,16,17);1-2H3/b14-12+; |
| InChIKey | MVBVJIZXEYPCIO-UNGNXWFZSA-N |
| XLogP | 4.23 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.49 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|