C21H35N3 — CID 143053469
N-[3-[4-(but-1-en-2-ylamino)cyclohexa-1,3-dien-1-yl]prop-1-en-2-yl]-N'-(3,3-dimethylbutyl)ethanimidamide (PubChem CID 143053469) has the molecular formula C21H35N3 and a molecular weight of 329.53 g/mol. Its IUPAC name is N-[3-[4-(but-1-en-2-ylamino)cyclohexa-1,3-dien-1-yl]prop-1-en-2-yl]-N'-(3,3-dimethylbutyl)ethanimidamide.
| Compound Name | N-[3-[4-(but-1-en-2-ylamino)cyclohexa-1,3-dien-1-yl]prop-1-en-2-yl]-N'-(3,3-dimethylbutyl)ethanimidamide |
|---|---|
| PubChem CID | 143053469 |
| Molecular Formula | C21H35N3 |
| Molecular Weight | 329.53 g/mol |
| Exact Mass | 329.28 |
| IUPAC Name | N-[3-[4-(but-1-en-2-ylamino)cyclohexa-1,3-dien-1-yl]prop-1-en-2-yl]-N'-(3,3-dimethylbutyl)ethanimidamide |
| SMILES | C=C(CC)NC1=CC=C(CC(=C)N/C(C)=N/CCC(C)(C)C)CC1 |
| InChI | InChI=1S/C21H35N3/c1-8-16(2)24-20-11-9-19(10-12-20)15-17(3)23-18(4)22-14-13-21(5,6)7/h9,11,24H,2-3,8,10,12-15H2,1,4-7H3,(H,22,23) |
| InChIKey | ICIZBENUPWQCIQ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.53 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|