C20H38N2 — CID 142469666
N'-(3-ethyl-2,3-dimethyl-2-propan-2-ylpentyl)-N-[(2Z)-4-methylpenta-2,4-dien-2-yl]ethanimidamide (PubChem CID 142469666) has the molecular formula C20H38N2 and a molecular weight of 306.54 g/mol. Its IUPAC name is N'-(3-ethyl-2,3-dimethyl-2-propan-2-ylpentyl)-N-[(2Z)-4-methylpenta-2,4-dien-2-yl]ethanimidamide.
| Compound Name | N'-(3-ethyl-2,3-dimethyl-2-propan-2-ylpentyl)-N-[(2Z)-4-methylpenta-2,4-dien-2-yl]ethanimidamide |
|---|---|
| PubChem CID | 142469666 |
| Molecular Formula | C20H38N2 |
| Molecular Weight | 306.54 g/mol |
| Exact Mass | 306.30 |
| IUPAC Name | N'-(3-ethyl-2,3-dimethyl-2-propan-2-ylpentyl)-N-[(2Z)-4-methylpenta-2,4-dien-2-yl]ethanimidamide |
| SMILES | C=C(C)/C=C(/C)N/C(C)=N/CC(C)(C(C)C)C(C)(CC)CC |
| InChI | InChI=1S/C20H38N2/c1-11-19(9,12-2)20(10,16(5)6)14-21-18(8)22-17(7)13-15(3)4/h13,16H,3,11-12,14H2,1-2,4-10H3,(H,21,22)/b17-13- |
| InChIKey | GPYIJJGUEZTBNZ-LGMDPLHJSA-N |
| XLogP | 5.96 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.54 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|