C15H26N2 — CID 123512382
N-(3,4-dimethyl-3-propan-2-ylhepta-1,4,6-trien-2-yl)-N'-methylethanimidamide (PubChem CID 123512382) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is N-(3,4-dimethyl-3-propan-2-ylhepta-1,4,6-trien-2-yl)-N'-methylethanimidamide.
| Compound Name | N-(3,4-dimethyl-3-propan-2-ylhepta-1,4,6-trien-2-yl)-N'-methylethanimidamide |
|---|---|
| PubChem CID | 123512382 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | N-(3,4-dimethyl-3-propan-2-ylhepta-1,4,6-trien-2-yl)-N'-methylethanimidamide |
| SMILES | C=CC=C(C)C(C)(C(=C)N/C(C)=N/C)C(C)C |
| InChI | InChI=1S/C15H26N2/c1-9-10-12(4)15(7,11(2)3)13(5)17-14(6)16-8/h9-11H,1,5H2,2-4,6-8H3,(H,16,17) |
| InChIKey | RMQUYTPNFOFVRF-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|