C18H30N2 — CID 143871760
N-[(3E)-6-methylhepta-3,5-dien-3-yl]-N'-[(2Z)-3-propan-2-ylpenta-2,4-dien-2-yl]ethanimidamide (PubChem CID 143871760) has the molecular formula C18H30N2 and a molecular weight of 274.45 g/mol. Its IUPAC name is N-[(3E)-6-methylhepta-3,5-dien-3-yl]-N'-[(2Z)-3-propan-2-ylpenta-2,4-dien-2-yl]ethanimidamide.
| Compound Name | N-[(3E)-6-methylhepta-3,5-dien-3-yl]-N'-[(2Z)-3-propan-2-ylpenta-2,4-dien-2-yl]ethanimidamide |
|---|---|
| PubChem CID | 143871760 |
| Molecular Formula | C18H30N2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.24 |
| IUPAC Name | N-[(3E)-6-methylhepta-3,5-dien-3-yl]-N'-[(2Z)-3-propan-2-ylpenta-2,4-dien-2-yl]ethanimidamide |
| SMILES | C=C/C(=C(C)\N=C(/C)N/C(=C/C=C(C)C)CC)C(C)C |
| InChI | InChI=1S/C18H30N2/c1-9-17(12-11-13(3)4)20-16(8)19-15(7)18(10-2)14(5)6/h10-12,14H,2,9H2,1,3-8H3,(H,19,20)/b17-12+,18-15+ |
| InChIKey | PNZIQWKPWYNXTP-NLKSIUOISA-N |
| XLogP | 5.37 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|