C13H24N2 — CID 123677229
N-(2,6-dimethylocta-4,6-dien-2-yl)-N'-methylethanimidamide (PubChem CID 123677229) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is N-(2,6-dimethylocta-4,6-dien-2-yl)-N'-methylethanimidamide.
| Compound Name | N-(2,6-dimethylocta-4,6-dien-2-yl)-N'-methylethanimidamide |
|---|---|
| PubChem CID | 123677229 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | N-(2,6-dimethylocta-4,6-dien-2-yl)-N'-methylethanimidamide |
| SMILES | CC=C(C)C=CCC(C)(C)N/C(C)=N/C |
| InChI | InChI=1S/C13H24N2/c1-7-11(2)9-8-10-13(4,5)15-12(3)14-6/h7-9H,10H2,1-6H3,(H,14,15) |
| InChIKey | RQPFIJRJKRMWNT-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|