C13H22N2 — CID 143585579
N-butan-2-yl-5,7,7-trimethyl-1H-azepin-2-imine (PubChem CID 143585579) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is N-butan-2-yl-5,7,7-trimethyl-1H-azepin-2-imine.
| Compound Name | N-butan-2-yl-5,7,7-trimethyl-1H-azepin-2-imine |
|---|---|
| PubChem CID | 143585579 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | N-butan-2-yl-5,7,7-trimethyl-1H-azepin-2-imine |
| SMILES | CCC(C)/N=C1\C=CC(C)=CC(C)(C)N1 |
| InChI | InChI=1S/C13H22N2/c1-6-11(3)14-12-8-7-10(2)9-13(4,5)15-12/h7-9,11H,6H2,1-5H3,(H,14,15) |
| InChIKey | LMZXLDPTASDOCT-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|