C21H30N2 — CID 145174461
ethene;N'-[(4Z,6Z)-octa-4,6-dien-2-yl]-N-prop-1-en-2-ylcyclohepta-1,3,6-triene-1-carboximidamide (PubChem CID 145174461) has the molecular formula C21H30N2 and a molecular weight of 310.49 g/mol. Its IUPAC name is ethene;N'-[(4Z,6Z)-octa-4,6-dien-2-yl]-N-prop-1-en-2-ylcyclohepta-1,3,6-triene-1-carboximidamide.
| Compound Name | ethene;N'-[(4Z,6Z)-octa-4,6-dien-2-yl]-N-prop-1-en-2-ylcyclohepta-1,3,6-triene-1-carboximidamide |
|---|---|
| PubChem CID | 145174461 |
| Molecular Formula | C21H30N2 |
| Molecular Weight | 310.49 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | ethene;N'-[(4Z,6Z)-octa-4,6-dien-2-yl]-N-prop-1-en-2-ylcyclohepta-1,3,6-triene-1-carboximidamide |
| SMILES | C=C.C=C(C)N/C(=N\C(C)C/C=C\C=C/C)C1=CC=CCC=C1 |
| InChI | InChI=1S/C19H26N2.C2H4/c1-5-6-7-10-13-17(4)21-19(20-16(2)3)18-14-11-8-9-12-15-18;1-2/h5-8,10-12,14-15,17H,2,9,13H2,1,3-4H3,(H,20,21);1-2H2/b6-5-,10-7-; |
| InChIKey | QIVNLLRLTFTKGI-LNWSVNOOSA-N |
| XLogP | 5.66 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.49 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|