C14H20N2 — CID 166882348
6,6-dimethyl-2-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-4,5-dihydro-1H-pyrimidine (PubChem CID 166882348) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 6,6-dimethyl-2-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-4,5-dihydro-1H-pyrimidine.
| Compound Name | 6,6-dimethyl-2-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-4,5-dihydro-1H-pyrimidine |
|---|---|
| PubChem CID | 166882348 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 6,6-dimethyl-2-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]-4,5-dihydro-1H-pyrimidine |
| SMILES | C=C/C=C\C(=C/C=C)C1=NCCC(C)(C)N1 |
| InChI | InChI=1S/C14H20N2/c1-5-7-9-12(8-6-2)13-15-11-10-14(3,4)16-13/h5-9H,1-2,10-11H2,3-4H3,(H,15,16)/b9-7-,12-8+ |
| InChIKey | SHMZCKJRBVAWIW-ZUQSVMQASA-N |
| XLogP | 3.01 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|