About 2-N,6-N-dibutyl-5-ethyl-3H-pyridine-2,6-diimine
2-N,6-N-dibutyl-5-ethyl-3H-pyridine-2,6-diimine (PubChem CID 137053045) has the molecular formula C15H27N3
and a molecular weight of 249.40 g/mol. Its IUPAC name is 2-N,6-N-dibutyl-5-ethyl-3H-pyridine-2,6-diimine.
Molecular Properties
| Compound Name | 2-N,6-N-dibutyl-5-ethyl-3H-pyridine-2,6-diimine |
| PubChem CID | 137053045 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | 2-N,6-N-dibutyl-5-ethyl-3H-pyridine-2,6-diimine |
| SMILES | CCCC/N=C1\N/C(=N/CCCC)CC=C1CC |
| InChI | InChI=1S/C15H27N3/c1-4-7-11-16-14-10-9-13(6-3)15(18-14)17-12-8-5-2/h9H,4-8,10-12H2,1-3H3,(H,16,17,18) |
| InChIKey | AZHOOYWSMQLRKH-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-N,6-N-dibutyl-5-ethyl-3H-pyridine-2,6-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,6-N-dibutyl-5-ethyl-3H-pyridine-2,6-diimine?
The IUPAC name of 2-N,6-N-dibutyl-5-ethyl-3H-pyridine-2,6-diimine (CID 137053045) is 2-N,6-N-dibutyl-5-ethyl-3H-pyridine-2,6-diimine.
What is the SMILES notation for 2-N,6-N-dibutyl-5-ethyl-3H-pyridine-2,6-diimine?
The canonical SMILES for 2-N,6-N-dibutyl-5-ethyl-3H-pyridine-2,6-diimine is CCCC/N=C1\N/C(=N/CCCC)CC=C1CC.
What is the InChIKey of 2-N,6-N-dibutyl-5-ethyl-3H-pyridine-2,6-diimine?
The InChIKey is AZHOOYWSMQLRKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27N3/c1-4-7-11-16-14-10-9-13(6-3)15(18-14)17-12-8-5-2/h9H,4-8,10-12H2,1-3H3,(H,16,17,18).
What are the key properties of 2-N,6-N-dibutyl-5-ethyl-3H-pyridine-2,6-diimine?
2-N,6-N-dibutyl-5-ethyl-3H-pyridine-2,6-diimine has a molecular weight of 249.40 g/mol, XLogP of 3.71, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,6-N-dibutyl-5-ethyl-3H-pyridine-2,6-diimine is sourced from PubChem (CID 137053045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).