C14H24N2 — CID 89311716
(3E,5Z)-N-ethyl-N',3,6,7-tetramethylocta-3,5,7-trienimidamide (PubChem CID 89311716) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is (3E,5Z)-N-ethyl-N',3,6,7-tetramethylocta-3,5,7-trienimidamide.
| Compound Name | (3E,5Z)-N-ethyl-N',3,6,7-tetramethylocta-3,5,7-trienimidamide |
|---|---|
| PubChem CID | 89311716 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | (3E,5Z)-N-ethyl-N',3,6,7-tetramethylocta-3,5,7-trienimidamide |
| SMILES | C=C(C)/C(C)=C\C=C(/C)C/C(=N/C)NCC |
| InChI | InChI=1S/C14H24N2/c1-7-16-14(15-6)10-12(4)8-9-13(5)11(2)3/h8-9H,2,7,10H2,1,3-6H3,(H,15,16)/b12-8+,13-9- |
| InChIKey | BUCSAMCNWSAYCY-UQXQTEIVSA-N |
| XLogP | 3.48 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|