C12H18N2 — CID 123923845
9-ethenyl-2,6-dimethyl-1,4,9,10-tetrahydro-1,3-diazecine (PubChem CID 123923845) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 9-ethenyl-2,6-dimethyl-1,4,9,10-tetrahydro-1,3-diazecine.
| Compound Name | 9-ethenyl-2,6-dimethyl-1,4,9,10-tetrahydro-1,3-diazecine |
|---|---|
| PubChem CID | 123923845 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 9-ethenyl-2,6-dimethyl-1,4,9,10-tetrahydro-1,3-diazecine |
| SMILES | C=CC1C=CC(C)=CC/N=C(\C)NC1 |
| InChI | InChI=1S/C12H18N2/c1-4-12-6-5-10(2)7-8-13-11(3)14-9-12/h4-7,12H,1,8-9H2,2-3H3,(H,13,14) |
| InChIKey | AOPUDKOURWQEEK-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|