C11H17ClN3+ — CID 123349781
4-chloro-2-hexa-2,4-dien-3-yl-5,6-dimethyl-1,2-dihydro-1,3,5-triazin-5-ium (PubChem CID 123349781) has the molecular formula C11H17ClN3+ and a molecular weight of 226.73 g/mol. Its IUPAC name is 4-chloro-2-hexa-2,4-dien-3-yl-5,6-dimethyl-1,2-dihydro-1,3,5-triazin-5-ium.
| Compound Name | 4-chloro-2-hexa-2,4-dien-3-yl-5,6-dimethyl-1,2-dihydro-1,3,5-triazin-5-ium |
|---|---|
| PubChem CID | 123349781 |
| Molecular Formula | C11H17ClN3+ |
| Molecular Weight | 226.73 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 4-chloro-2-hexa-2,4-dien-3-yl-5,6-dimethyl-1,2-dihydro-1,3,5-triazin-5-ium |
| SMILES | CC=CC(=CC)C1N=C(Cl)[N+](C)=C(C)N1 |
| InChI | InChI=1S/C11H16ClN3/c1-5-7-9(6-2)10-13-8(3)15(4)11(12)14-10/h5-7,10H,1-4H3/p+1 |
| InChIKey | VOZPJQJHYUCHGV-UHFFFAOYSA-O |
| XLogP | 2.09 |
| TPSA | 27.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.73 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|