C9H11ClN2 — CID 143713255
(5Z)-5-(2-chloroprop-2-enylidene)-N-methyl-1,2-dihydropyridin-6-imine (PubChem CID 143713255) has the molecular formula C9H11ClN2 and a molecular weight of 182.65 g/mol. Its IUPAC name is (5Z)-5-(2-chloroprop-2-enylidene)-N-methyl-1,2-dihydropyridin-6-imine.
| Compound Name | (5Z)-5-(2-chloroprop-2-enylidene)-N-methyl-1,2-dihydropyridin-6-imine |
|---|---|
| PubChem CID | 143713255 |
| Molecular Formula | C9H11ClN2 |
| Molecular Weight | 182.65 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | (5Z)-5-(2-chloroprop-2-enylidene)-N-methyl-1,2-dihydropyridin-6-imine |
| SMILES | C=C(Cl)/C=C1/C=CCN/C1=N\C |
| InChI | InChI=1S/C9H11ClN2/c1-7(10)6-8-4-3-5-12-9(8)11-2/h3-4,6H,1,5H2,2H3,(H,11,12)/b8-6- |
| InChIKey | LFSYQJOFMHDTHF-VURMDHGXSA-N |
| XLogP | 1.85 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.65 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|