C9H11ClN2 — CID 123798047
2-[(3E)-4-chloropenta-1,3-dien-2-yl]-1,4-dihydropyrimidine (PubChem CID 123798047) has the molecular formula C9H11ClN2 and a molecular weight of 182.65 g/mol. Its IUPAC name is 2-[(3E)-4-chloropenta-1,3-dien-2-yl]-1,4-dihydropyrimidine.
| Compound Name | 2-[(3E)-4-chloropenta-1,3-dien-2-yl]-1,4-dihydropyrimidine |
|---|---|
| PubChem CID | 123798047 |
| Molecular Formula | C9H11ClN2 |
| Molecular Weight | 182.65 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | 2-[(3E)-4-chloropenta-1,3-dien-2-yl]-1,4-dihydropyrimidine |
| SMILES | C=C(/C=C(\C)Cl)C1=NCC=CN1 |
| InChI | InChI=1S/C9H11ClN2/c1-7(6-8(2)10)9-11-4-3-5-12-9/h3-4,6H,1,5H2,2H3,(H,11,12)/b8-6+ |
| InChIKey | ANOYAQWWBWQKAQ-SOFGYWHQSA-N |
| XLogP | 2.20 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.65 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|