C9H9ClFN3 — CID 178151787
(Z,2E)-2-(6-chloro-1H-pyrimidin-4-ylidene)pent-3-enimidoyl fluoride (PubChem CID 178151787) has the molecular formula C9H9ClFN3 and a molecular weight of 213.64 g/mol. Its IUPAC name is (Z,2E)-2-(6-chloro-1H-pyrimidin-4-ylidene)pent-3-enimidoyl fluoride.
| Compound Name | (Z,2E)-2-(6-chloro-1H-pyrimidin-4-ylidene)pent-3-enimidoyl fluoride |
|---|---|
| PubChem CID | 178151787 |
| Molecular Formula | C9H9ClFN3 |
| Molecular Weight | 213.64 g/mol |
| Exact Mass | 213.05 |
| IUPAC Name | (Z,2E)-2-(6-chloro-1H-pyrimidin-4-ylidene)pent-3-enimidoyl fluoride |
| SMILES | [H]/N=C(F)/C(/C=C\C)=C1\C=C(Cl)NC=N1 |
| InChI | InChI=1S/C9H9ClFN3/c1-2-3-6(9(11)12)7-4-8(10)14-5-13-7/h2-5,12H,1H3,(H,13,14)/b3-2-,7-6+,12-9- |
| InChIKey | RCPNWYRZWZVJRU-PYOZLSSXSA-N |
| XLogP | 2.48 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.64 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|