C14H23ClFN3 — CID 178151786
(Z,2E)-2-(6-chloro-1H-pyrimidin-4-ylidene)pent-3-enimidoyl fluoride;ethane;propane (PubChem CID 178151786) has the molecular formula C14H23ClFN3 and a molecular weight of 287.81 g/mol. Its IUPAC name is (Z,2E)-2-(6-chloro-1H-pyrimidin-4-ylidene)pent-3-enimidoyl fluoride;ethane;propane.
| Compound Name | (Z,2E)-2-(6-chloro-1H-pyrimidin-4-ylidene)pent-3-enimidoyl fluoride;ethane;propane |
|---|---|
| PubChem CID | 178151786 |
| Molecular Formula | C14H23ClFN3 |
| Molecular Weight | 287.81 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | (Z,2E)-2-(6-chloro-1H-pyrimidin-4-ylidene)pent-3-enimidoyl fluoride;ethane;propane |
| SMILES | CC.CCC.[H]/N=C(F)/C(/C=C\C)=C1\C=C(Cl)NC=N1 |
| InChI | InChI=1S/C9H9ClFN3.C3H8.C2H6/c1-2-3-6(9(11)12)7-4-8(10)14-5-13-7;1-3-2;1-2/h2-5,12H,1H3,(H,13,14);3H2,1-2H3;1-2H3/b3-2-,7-6+,12-9-;; |
| InChIKey | SMVOCNGDCOCALD-BXRITGJISA-N |
| XLogP | 4.92 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.81 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|