C9H14N2 — CID 123914489
N-ethenyl-5-ethyl-2,3-dihydropyridin-6-amine (PubChem CID 123914489) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is N-ethenyl-5-ethyl-2,3-dihydropyridin-6-amine.
| Compound Name | N-ethenyl-5-ethyl-2,3-dihydropyridin-6-amine |
|---|---|
| PubChem CID | 123914489 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | N-ethenyl-5-ethyl-2,3-dihydropyridin-6-amine |
| SMILES | C=CNC1=NCCC=C1CC |
| InChI | InChI=1S/C9H14N2/c1-3-8-6-5-7-11-9(8)10-4-2/h4,6H,2-3,5,7H2,1H3,(H,10,11) |
| InChIKey | YSLXDRJVTQSLHU-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |