C11H16N2 — CID 123477375
N-ethenyl-3-ethyl-6-methyl-4H-azepin-7-amine (PubChem CID 123477375) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is N-ethenyl-3-ethyl-6-methyl-4H-azepin-7-amine.
| Compound Name | N-ethenyl-3-ethyl-6-methyl-4H-azepin-7-amine |
|---|---|
| PubChem CID | 123477375 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | N-ethenyl-3-ethyl-6-methyl-4H-azepin-7-amine |
| SMILES | C=CNC1=NC=C(CC)CC=C1C |
| InChI | InChI=1S/C11H16N2/c1-4-10-7-6-9(3)11(12-5-2)13-8-10/h5-6,8H,2,4,7H2,1,3H3,(H,12,13) |
| InChIKey | SHEIDHUQYNGYKD-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |