C13H21ClN2 — CID 123286684
(2E)-N-(1-chloroethenyl)-N'-ethyl-2-methylocta-2,6-dienimidamide (PubChem CID 123286684) has the molecular formula C13H21ClN2 and a molecular weight of 240.78 g/mol. Its IUPAC name is (2E)-N-(1-chloroethenyl)-N'-ethyl-2-methylocta-2,6-dienimidamide.
| Compound Name | (2E)-N-(1-chloroethenyl)-N'-ethyl-2-methylocta-2,6-dienimidamide |
|---|---|
| PubChem CID | 123286684 |
| Molecular Formula | C13H21ClN2 |
| Molecular Weight | 240.78 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | (2E)-N-(1-chloroethenyl)-N'-ethyl-2-methylocta-2,6-dienimidamide |
| SMILES | C=C(Cl)NC(=N\CC)/C(C)=C/CCC=CC |
| InChI | InChI=1S/C13H21ClN2/c1-5-7-8-9-10-11(3)13(15-6-2)16-12(4)14/h5,7,10H,4,6,8-9H2,1-3H3,(H,15,16)/b7-5?,11-10+ |
| InChIKey | UQAQUJONTDJKLG-LKRVBFKCSA-N |
| XLogP | 4.01 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.78 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|