About 3-(1-chloroethenylamino)-2-methyl-N'-[(Z,2R)-3-methylhept-3-en-2-yl]prop-2-enimidamide
3-(1-chloroethenylamino)-2-methyl-N'-[(Z,2R)-3-methylhept-3-en-2-yl]prop-2-enimidamide (PubChem CID 173489057) has the molecular formula C14H24ClN3
and a molecular weight of 269.82 g/mol. Its IUPAC name is 3-(1-chloroethenylamino)-2-methyl-N'-[(Z,2R)-3-methylhept-3-en-2-yl]prop-2-enimidamide.
Molecular Properties
| Compound Name | 3-(1-chloroethenylamino)-2-methyl-N'-[(Z,2R)-3-methylhept-3-en-2-yl]prop-2-enimidamide |
| PubChem CID | 173489057 |
| Molecular Formula | C14H24ClN3 |
| Molecular Weight | 269.82 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | 3-(1-chloroethenylamino)-2-methyl-N'-[(Z,2R)-3-methylhept-3-en-2-yl]prop-2-enimidamide |
| SMILES | C=C(Cl)NC=C(C)/C(N)=N/[C@H](C)/C(C)=C\CCC |
| InChI | InChI=1S/C14H24ClN3/c1-6-7-8-10(2)12(4)18-14(16)11(3)9-17-13(5)15/h8-9,12,17H,5-7H2,1-4H3,(H2,16,18)/b10-8-,11-9?/t12-/m1/s1 |
| InChIKey | MQSJYTCZJRFLLL-IOEDTLEKSA-N |
| XLogP | 3.68 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.82 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-chloroethenylamino)-2-methyl-N'-[(Z,2R)-3-methylhept-3-en-2-yl]prop-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-chloroethenylamino)-2-methyl-N'-[(Z,2R)-3-methylhept-3-en-2-yl]prop-2-enimidamide?
The IUPAC name of 3-(1-chloroethenylamino)-2-methyl-N'-[(Z,2R)-3-methylhept-3-en-2-yl]prop-2-enimidamide (CID 173489057) is 3-(1-chloroethenylamino)-2-methyl-N'-[(Z,2R)-3-methylhept-3-en-2-yl]prop-2-enimidamide.
What is the SMILES notation for 3-(1-chloroethenylamino)-2-methyl-N'-[(Z,2R)-3-methylhept-3-en-2-yl]prop-2-enimidamide?
The canonical SMILES for 3-(1-chloroethenylamino)-2-methyl-N'-[(Z,2R)-3-methylhept-3-en-2-yl]prop-2-enimidamide is C=C(Cl)NC=C(C)/C(N)=N/[C@H](C)/C(C)=C\CCC.
What is the InChIKey of 3-(1-chloroethenylamino)-2-methyl-N'-[(Z,2R)-3-methylhept-3-en-2-yl]prop-2-enimidamide?
The InChIKey is MQSJYTCZJRFLLL-IOEDTLEKSA-N. The full InChI is InChI=1S/C14H24ClN3/c1-6-7-8-10(2)12(4)18-14(16)11(3)9-17-13(5)15/h8-9,12,17H,5-7H2,1-4H3,(H2,16,18)/b10-8-,11-9?/t12-/m1/s1.
What are the key properties of 3-(1-chloroethenylamino)-2-methyl-N'-[(Z,2R)-3-methylhept-3-en-2-yl]prop-2-enimidamide?
3-(1-chloroethenylamino)-2-methyl-N'-[(Z,2R)-3-methylhept-3-en-2-yl]prop-2-enimidamide has a molecular weight of 269.82 g/mol, XLogP of 3.68, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-chloroethenylamino)-2-methyl-N'-[(Z,2R)-3-methylhept-3-en-2-yl]prop-2-enimidamide is sourced from PubChem (CID 173489057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).