C9H11ClN2 — CID 143712815
(3Z)-N-[(E)-2-chloroethenyl]-3-ethylidene-4H-pyridin-2-amine (PubChem CID 143712815) has the molecular formula C9H11ClN2 and a molecular weight of 182.65 g/mol. Its IUPAC name is (3Z)-N-[(E)-2-chloroethenyl]-3-ethylidene-4H-pyridin-2-amine.
| Compound Name | (3Z)-N-[(E)-2-chloroethenyl]-3-ethylidene-4H-pyridin-2-amine |
|---|---|
| PubChem CID | 143712815 |
| Molecular Formula | C9H11ClN2 |
| Molecular Weight | 182.65 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | (3Z)-N-[(E)-2-chloroethenyl]-3-ethylidene-4H-pyridin-2-amine |
| SMILES | C/C=C1/CC=CN=C1N/C=C/Cl |
| InChI | InChI=1S/C9H11ClN2/c1-2-8-4-3-6-11-9(8)12-7-5-10/h2-3,5-7H,4H2,1H3,(H,11,12)/b7-5+,8-2- |
| InChIKey | OGLSCAVXBSHCON-NCIZPPAFSA-N |
| XLogP | 2.55 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.65 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |