C8H9ClN2 — CID 143711961
5-chloro-3-methyl-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine (PubChem CID 143711961) has the molecular formula C8H9ClN2 and a molecular weight of 168.63 g/mol. Its IUPAC name is 5-chloro-3-methyl-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 5-chloro-3-methyl-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 143711961 |
| Molecular Formula | C8H9ClN2 |
| Molecular Weight | 168.63 g/mol |
| Exact Mass | 168.05 |
| IUPAC Name | 5-chloro-3-methyl-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine |
| SMILES | Cc1c[nH]c2c1=CC(Cl)CN=2 |
| InChI | InChI=1S/C8H9ClN2/c1-5-3-10-8-7(5)2-6(9)4-11-8/h2-3,6H,4H2,1H3,(H,10,11) |
| InChIKey | YBZDBRACBYANEW-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.63 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|