C9H13ClN2 — CID 143712066
5-chloro-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine;ethane (PubChem CID 143712066) has the molecular formula C9H13ClN2 and a molecular weight of 184.67 g/mol. Its IUPAC name is 5-chloro-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine;ethane.
| Compound Name | 5-chloro-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine;ethane |
|---|---|
| PubChem CID | 143712066 |
| Molecular Formula | C9H13ClN2 |
| Molecular Weight | 184.67 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 5-chloro-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine;ethane |
| SMILES | CC.ClC1C=c2cc[nH]c2=NC1 |
| InChI | InChI=1S/C7H7ClN2.C2H6/c8-6-3-5-1-2-9-7(5)10-4-6;1-2/h1-3,6H,4H2,(H,9,10);1-2H3 |
| InChIKey | ATGXHSHXFHBICS-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.67 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|