C7H9FN2 — CID 142308839
6-fluoro-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine;molecular hydrogen (PubChem CID 142308839) has the molecular formula C7H9FN2 and a molecular weight of 140.16 g/mol. Its IUPAC name is 6-fluoro-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine;molecular hydrogen.
| Compound Name | 6-fluoro-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine;molecular hydrogen |
|---|---|
| PubChem CID | 142308839 |
| Molecular Formula | C7H9FN2 |
| Molecular Weight | 140.16 g/mol |
| Exact Mass | 140.07 |
| IUPAC Name | 6-fluoro-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine;molecular hydrogen |
| SMILES | FC1CC=c2cc[nH]c2=N1.[H][H] |
| InChI | InChI=1S/C7H7FN2.H2/c8-6-2-1-5-3-4-9-7(5)10-6;/h1,3-4,6H,2H2,(H,9,10);1H |
| InChIKey | DLPVRMHGEYWTIX-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.16 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|