C9H10F3N2+ — CID 163621742
3-methyl-5-(trifluoromethyl)-5,6-dihydro-1H-pyrrolo[2,3-b]pyridin-1-ium (PubChem CID 163621742) has the molecular formula C9H10F3N2+ and a molecular weight of 203.19 g/mol. Its IUPAC name is 3-methyl-5-(trifluoromethyl)-5,6-dihydro-1H-pyrrolo[2,3-b]pyridin-1-ium.
| Compound Name | 3-methyl-5-(trifluoromethyl)-5,6-dihydro-1H-pyrrolo[2,3-b]pyridin-1-ium |
|---|---|
| PubChem CID | 163621742 |
| Molecular Formula | C9H10F3N2+ |
| Molecular Weight | 203.19 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | 3-methyl-5-(trifluoromethyl)-5,6-dihydro-1H-pyrrolo[2,3-b]pyridin-1-ium |
| SMILES | CC1=C[NH2+]C2=NCC(C(F)(F)F)C=C12 |
| InChI | InChI=1S/C9H9F3N2/c1-5-3-13-8-7(5)2-6(4-14-8)9(10,11)12/h2-3,6H,4H2,1H3,(H,13,14)/p+1 |
| InChIKey | HORNXYHADPRINO-UHFFFAOYSA-O |
| XLogP | 0.98 |
| TPSA | 28.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.19 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'} |
|---|