C8H10N2 — CID 143384775
5-methyl-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine (PubChem CID 143384775) has the molecular formula C8H10N2 and a molecular weight of 134.18 g/mol. Its IUPAC name is 5-methyl-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 5-methyl-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 143384775 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | 5-methyl-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine |
| SMILES | CC1C=c2cc[nH]c2=NC1 |
| InChI | InChI=1S/C8H10N2/c1-6-4-7-2-3-9-8(7)10-5-6/h2-4,6H,5H2,1H3,(H,9,10) |
| InChIKey | CKJOXATYVZFPQY-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |