C7H5N2W- — CID 58431408
1,4-dihydropyrrolo[2,3-b]pyridin-4-ide;tungsten (PubChem CID 58431408) has the molecular formula C7H5N2W- and a molecular weight of 300.97 g/mol. Its IUPAC name is 1,4-dihydropyrrolo[2,3-b]pyridin-4-ide;tungsten.
| Compound Name | 1,4-dihydropyrrolo[2,3-b]pyridin-4-ide;tungsten |
|---|---|
| PubChem CID | 58431408 |
| Molecular Formula | C7H5N2W- |
| Molecular Weight | 300.97 g/mol |
| Exact Mass | 301.00 |
| IUPAC Name | 1,4-dihydropyrrolo[2,3-b]pyridin-4-ide;tungsten |
| SMILES | [W].[c-]1ccnc2[nH]ccc12 |
| InChI | InChI=1S/C7H5N2.W/c1-2-6-3-5-9-7(6)8-4-1;/h1,3-5H,(H,8,9);/q-1; |
| InChIKey | RSGKPGISLBKTTL-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.97 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|