C6H4N3W- — CID 140806118
4,7-dihydropyrrolo[2,3-d]pyrimidin-4-ide;tungsten (PubChem CID 140806118) has the molecular formula C6H4N3W- and a molecular weight of 301.96 g/mol. Its IUPAC name is 4,7-dihydropyrrolo[2,3-d]pyrimidin-4-ide;tungsten.
| Compound Name | 4,7-dihydropyrrolo[2,3-d]pyrimidin-4-ide;tungsten |
|---|---|
| PubChem CID | 140806118 |
| Molecular Formula | C6H4N3W- |
| Molecular Weight | 301.96 g/mol |
| Exact Mass | 301.99 |
| IUPAC Name | 4,7-dihydropyrrolo[2,3-d]pyrimidin-4-ide;tungsten |
| SMILES | [W].[c-]1ncnc2[nH]ccc12 |
| InChI | InChI=1S/C6H4N3.W/c1-2-8-6-5(1)3-7-4-9-6;/h1-2,4H,(H,7,8,9);/q-1; |
| InChIKey | GRWWPNSQWOKOSE-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.96 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|