C6H4N3- — CID 150748099
4,7-dihydropyrrolo[2,3-d]pyrimidin-4-ide (PubChem CID 150748099) has the molecular formula C6H4N3- and a molecular weight of 118.12 g/mol. Its IUPAC name is 4,7-dihydropyrrolo[2,3-d]pyrimidin-4-ide.
| Compound Name | 4,7-dihydropyrrolo[2,3-d]pyrimidin-4-ide |
|---|---|
| PubChem CID | 150748099 |
| Molecular Formula | C6H4N3- |
| Molecular Weight | 118.12 g/mol |
| Exact Mass | 118.04 |
| IUPAC Name | 4,7-dihydropyrrolo[2,3-d]pyrimidin-4-ide |
| SMILES | [c-]1ncnc2[nH]ccc12 |
| InChI | InChI=1S/C6H4N3/c1-2-8-6-5(1)3-7-4-9-6/h1-2,4H,(H,7,8,9)/q-1 |
| InChIKey | JVGYIQWDTQLJJV-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 118.12 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|