C11H14N2 — CID 143712881
N-[(1E)-2,3-dimethylbuta-1,3-dienyl]-3-methylidene-1H-pyrrol-2-imine (PubChem CID 143712881) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is N-[(1E)-2,3-dimethylbuta-1,3-dienyl]-3-methylidene-1H-pyrrol-2-imine.
| Compound Name | N-[(1E)-2,3-dimethylbuta-1,3-dienyl]-3-methylidene-1H-pyrrol-2-imine |
|---|---|
| PubChem CID | 143712881 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | N-[(1E)-2,3-dimethylbuta-1,3-dienyl]-3-methylidene-1H-pyrrol-2-imine |
| SMILES | C=C1C=CN/C1=N\C=C(/C)C(=C)C |
| InChI | InChI=1S/C11H14N2/c1-8(2)10(4)7-13-11-9(3)5-6-12-11/h5-7H,1,3H2,2,4H3,(H,12,13)/b10-7+ |
| InChIKey | IGKQMUFUPUCWKZ-JXMROGBWSA-N |
| XLogP | 2.54 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|