About (4Z)-N-ethenyl-4-ethylidene-2,3-dihydropyrrol-5-amine
(4Z)-N-ethenyl-4-ethylidene-2,3-dihydropyrrol-5-amine (PubChem CID 123900638) has the molecular formula C8H12N2
and a molecular weight of 136.20 g/mol. Its IUPAC name is (4Z)-N-ethenyl-4-ethylidene-2,3-dihydropyrrol-5-amine.
Analyze (4Z)-N-ethenyl-4-ethylidene-2,3-dihydropyrrol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-N-ethenyl-4-ethylidene-2,3-dihydropyrrol-5-amine?
The IUPAC name of (4Z)-N-ethenyl-4-ethylidene-2,3-dihydropyrrol-5-amine (CID 123900638) is (4Z)-N-ethenyl-4-ethylidene-2,3-dihydropyrrol-5-amine.
What is the SMILES notation for (4Z)-N-ethenyl-4-ethylidene-2,3-dihydropyrrol-5-amine?
The canonical SMILES for (4Z)-N-ethenyl-4-ethylidene-2,3-dihydropyrrol-5-amine is C=CNC1=NCC/C1=C/C.
What is the InChIKey of (4Z)-N-ethenyl-4-ethylidene-2,3-dihydropyrrol-5-amine?
The InChIKey is NLPLWOGWTSNTJH-CLTKARDFSA-N. The full InChI is InChI=1S/C8H12N2/c1-3-7-5-6-10-8(7)9-4-2/h3-4H,2,5-6H2,1H3,(H,9,10)/b7-3-.
What are the key properties of (4Z)-N-ethenyl-4-ethylidene-2,3-dihydropyrrol-5-amine?
(4Z)-N-ethenyl-4-ethylidene-2,3-dihydropyrrol-5-amine has a molecular weight of 136.20 g/mol, XLogP of 1.47, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-N-ethenyl-4-ethylidene-2,3-dihydropyrrol-5-amine is sourced from PubChem (CID 123900638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).