C12H10N2 — CID 91205102
8-methyl-4H-cyclopenta[c][1,8]naphthyridine (PubChem CID 91205102) has the molecular formula C12H10N2 and a molecular weight of 182.23 g/mol. Its IUPAC name is 8-methyl-4H-cyclopenta[c][1,8]naphthyridine.
| Compound Name | 8-methyl-4H-cyclopenta[c][1,8]naphthyridine |
|---|---|
| PubChem CID | 91205102 |
| Molecular Formula | C12H10N2 |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | 8-methyl-4H-cyclopenta[c][1,8]naphthyridine |
| SMILES | Cc1cc2cnc3[nH]cccc3c2c1 |
| InChI | InChI=1S/C12H10N2/c1-8-5-9-7-14-12-10(11(9)6-8)3-2-4-13-12/h2-7H,1H3,(H,13,14) |
| InChIKey | BULJNBJZEXQFBZ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |