C7H5N2OY- — CID 140643307
7-oxido-1,4-dihydropyrrolo[2,3-b]pyridin-7-ium-4-ide;yttrium (PubChem CID 140643307) has the molecular formula C7H5N2OY- and a molecular weight of 222.04 g/mol. Its IUPAC name is 7-oxido-1,4-dihydropyrrolo[2,3-b]pyridin-7-ium-4-ide;yttrium.
| Compound Name | 7-oxido-1,4-dihydropyrrolo[2,3-b]pyridin-7-ium-4-ide;yttrium |
|---|---|
| PubChem CID | 140643307 |
| Molecular Formula | C7H5N2OY- |
| Molecular Weight | 222.04 g/mol |
| Exact Mass | 221.95 |
| IUPAC Name | 7-oxido-1,4-dihydropyrrolo[2,3-b]pyridin-7-ium-4-ide;yttrium |
| SMILES | [O-][n+]1cc[c-]c2cc[nH]c21.[Y] |
| InChI | InChI=1S/C7H5N2O.Y/c10-9-5-1-2-6-3-4-8-7(6)9;/h1,3-5,8H;/q-1; |
| InChIKey | MKVAKRWNFATVJS-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 42.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.04 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|