About (Z)-N'-(3-methylidenepyrrol-2-yl)ethene-1,2-diamine
(Z)-N'-(3-methylidenepyrrol-2-yl)ethene-1,2-diamine (PubChem CID 147864393) has the molecular formula C7H9N3
and a molecular weight of 135.17 g/mol. Its IUPAC name is (Z)-N'-(3-methylidenepyrrol-2-yl)ethene-1,2-diamine.
Analyze (Z)-N'-(3-methylidenepyrrol-2-yl)ethene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N'-(3-methylidenepyrrol-2-yl)ethene-1,2-diamine?
The IUPAC name of (Z)-N'-(3-methylidenepyrrol-2-yl)ethene-1,2-diamine (CID 147864393) is (Z)-N'-(3-methylidenepyrrol-2-yl)ethene-1,2-diamine.
What is the SMILES notation for (Z)-N'-(3-methylidenepyrrol-2-yl)ethene-1,2-diamine?
The canonical SMILES for (Z)-N'-(3-methylidenepyrrol-2-yl)ethene-1,2-diamine is C=C1C=CN=C1N/C=C\N.
What is the InChIKey of (Z)-N'-(3-methylidenepyrrol-2-yl)ethene-1,2-diamine?
The InChIKey is HXISAHLEDGMDAR-HYXAFXHYSA-N. The full InChI is InChI=1S/C7H9N3/c1-6-2-4-9-7(6)10-5-3-8/h2-5H,1,8H2,(H,9,10)/b5-3-.
What are the key properties of (Z)-N'-(3-methylidenepyrrol-2-yl)ethene-1,2-diamine?
(Z)-N'-(3-methylidenepyrrol-2-yl)ethene-1,2-diamine has a molecular weight of 135.17 g/mol, XLogP of 0.49, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N'-(3-methylidenepyrrol-2-yl)ethene-1,2-diamine is sourced from PubChem (CID 147864393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).